C18H18N2 — CID 145157984
3-N-(2-cyclohexa-1,3-dien-1-ylphenyl)benzene-1,3-diamine (PubChem CID 145157984) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-N-(2-cyclohexa-1,3-dien-1-ylphenyl)benzene-1,3-diamine.
| Compound Name | 3-N-(2-cyclohexa-1,3-dien-1-ylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 145157984 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-N-(2-cyclohexa-1,3-dien-1-ylphenyl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ccccc2C2=CC=CCC2)c1 |
| InChI | InChI=1S/C18H18N2/c19-15-9-6-10-16(13-15)20-18-12-5-4-11-17(18)14-7-2-1-3-8-14/h1-2,4-7,9-13,20H,3,8,19H2 |
| InChIKey | SETGNRXUSYHYAT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|