C30H40N2O6S — CID 167258705
[7-methoxy-2-methyl-6-(oxolan-2-ylmethoxy)quinazolin-4-yl] 2,4,6-tripropylbenzenesulfonate (PubChem CID 167258705) has the molecular formula C30H40N2O6S and a molecular weight of 556.73 g/mol. Its IUPAC name is [7-methoxy-2-methyl-6-(oxolan-2-ylmethoxy)quinazolin-4-yl] 2,4,6-tripropylbenzenesulfonate.
| Compound Name | [7-methoxy-2-methyl-6-(oxolan-2-ylmethoxy)quinazolin-4-yl] 2,4,6-tripropylbenzenesulfonate |
|---|---|
| PubChem CID | 167258705 |
| Molecular Formula | C30H40N2O6S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [7-methoxy-2-methyl-6-(oxolan-2-ylmethoxy)quinazolin-4-yl] 2,4,6-tripropylbenzenesulfonate |
| SMILES | CCCc1cc(CCC)c(S(=O)(=O)Oc2nc(C)nc3cc(OC)c(OCC4CCCO4)cc23)c(CCC)c1 |
| InChI | InChI=1S/C30H40N2O6S/c1-6-10-21-15-22(11-7-2)29(23(16-21)12-8-3)39(33,34)38-30-25-17-28(37-19-24-13-9-14-36-24)27(35-5)18-26(25)31-20(4)32-30/h15-18,24H,6-14,19H2,1-5H3 |
| InChIKey | NUHYBDMQCAKSTP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|