C16H24BrClN5O5PSi — CID 16725957
9-[(4aR,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-8-bromopurin-6-amine (PubChem CID 16725957) has the molecular formula C16H24BrClN5O5PSi and a molecular weight of 540.82 g/mol. Its IUPAC name is 9-[(4aR,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-8-bromopurin-6-amine.
| Compound Name | 9-[(4aR,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-8-bromopurin-6-amine |
|---|---|
| PubChem CID | 16725957 |
| Molecular Formula | C16H24BrClN5O5PSi |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | 9-[(4aR,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-8-bromopurin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]2OP(=O)(Cl)OC[C@H]2O[C@H]1n1c(Br)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H24BrClN5O5PSi/c1-16(2,3)30(4,5)28-11-10-8(6-25-29(18,24)27-10)26-14(11)23-13-9(22-15(23)17)12(19)20-7-21-13/h7-8,10-11,14H,6H2,1-5H3,(H2,19,20,21)/t8-,10-,11-,14-,29?/m1/s1 |
| InChIKey | SVGXJMXAYURWRK-RLNQHHICSA-N |
| XLogP | 4.22 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|