C13H27F2NO2 — CID 167259777
N-(2,2-difluoroethyl)-3-(3-methoxy-3-methylbutoxy)-3-methylbutan-1-amine (PubChem CID 167259777) has the molecular formula C13H27F2NO2 and a molecular weight of 267.36 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-(3-methoxy-3-methylbutoxy)-3-methylbutan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-3-(3-methoxy-3-methylbutoxy)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 167259777 |
| Molecular Formula | C13H27F2NO2 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-(3-methoxy-3-methylbutoxy)-3-methylbutan-1-amine |
| SMILES | COC(C)(C)CCOC(C)(C)CCNCC(F)F |
| InChI | InChI=1S/C13H27F2NO2/c1-12(2,17-5)7-9-18-13(3,4)6-8-16-10-11(14)15/h11,16H,6-10H2,1-5H3 |
| InChIKey | BYWPZRQNNXDNRP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|