C17H23F5O2 — CID 134286097
1,2,3,4,5-pentafluoro-6-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]benzene (PubChem CID 134286097) has the molecular formula C17H23F5O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]benzene |
|---|---|
| PubChem CID | 134286097 |
| Molecular Formula | C17H23F5O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]benzene |
| SMILES | COC(C)(C)CCOC(C)(C)CCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H23F5O2/c1-16(2,23-5)8-9-24-17(3,4)7-6-10-11(18)13(20)15(22)14(21)12(10)19/h6-9H2,1-5H3 |
| InChIKey | CRXYOUFUHHSBFY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|