C36H42N4O6 — CID 16726053
3,8-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 16726053) has the molecular formula C36H42N4O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is 3,8-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3,8-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 16726053 |
| Molecular Formula | C36H42N4O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 3,8-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | COc1cc(-c2cc(CN3CC4CCC(C3)N4Cc3ccnc(-c4cc(OC)c(OC)c(OC)c4)c3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C36H42N4O6/c1-41-31-15-25(16-32(42-2)35(31)45-5)29-13-23(9-11-37-29)19-39-21-27-7-8-28(22-39)40(27)20-24-10-12-38-30(14-24)26-17-33(43-3)36(46-6)34(18-26)44-4/h9-18,27-28H,7-8,19-22H2,1-6H3 |
| InChIKey | SZXUJNXXESUELF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |