C40H24N4O — CID 167261542
7-(4,6-diphenylpyrimidin-2-yl)-2-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)quinoxaline (PubChem CID 167261542) has the molecular formula C40H24N4O and a molecular weight of 576.66 g/mol. Its IUPAC name is 7-(4,6-diphenylpyrimidin-2-yl)-2-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)quinoxaline.
| Compound Name | 7-(4,6-diphenylpyrimidin-2-yl)-2-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)quinoxaline |
|---|---|
| PubChem CID | 167261542 |
| Molecular Formula | C40H24N4O |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 7-(4,6-diphenylpyrimidin-2-yl)-2-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)quinoxaline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc4ncc(-c5ccc6c7c(cccc57)-c5ccccc5O6)nc4c3)n2)cc1 |
| InChI | InChI=1S/C40H24N4O/c1-3-10-25(11-4-1)33-23-34(26-12-5-2-6-13-26)44-40(43-33)27-18-20-32-35(22-27)42-36(24-41-32)28-19-21-38-39-30(28)15-9-16-31(39)29-14-7-8-17-37(29)45-38/h1-24H |
| InChIKey | FADCKCLNTHVVLT-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |