C17H16Cl3N3O2 — CID 167265896
N-(2-aminoethyl)-2,6-dichloro-3-[[2-(3-chlorophenyl)acetyl]amino]benzamide (PubChem CID 167265896) has the molecular formula C17H16Cl3N3O2 and a molecular weight of 400.69 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,6-dichloro-3-[[2-(3-chlorophenyl)acetyl]amino]benzamide.
| Compound Name | N-(2-aminoethyl)-2,6-dichloro-3-[[2-(3-chlorophenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 167265896 |
| Molecular Formula | C17H16Cl3N3O2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-(2-aminoethyl)-2,6-dichloro-3-[[2-(3-chlorophenyl)acetyl]amino]benzamide |
| SMILES | NCCNC(=O)c1c(Cl)ccc(NC(=O)Cc2cccc(Cl)c2)c1Cl |
| InChI | InChI=1S/C17H16Cl3N3O2/c18-11-3-1-2-10(8-11)9-14(24)23-13-5-4-12(19)15(16(13)20)17(25)22-7-6-21/h1-5,8H,6-7,9,21H2,(H,22,25)(H,23,24) |
| InChIKey | ASWNSYBVRPQQJK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |