C21H24FN3O3S — CID 167266539
[(2R,4R,6S)-5-azido-6-(2,4-dimethylphenyl)sulfanyl-4-fluoro-3-phenylmethoxyoxan-2-yl]methanol (PubChem CID 167266539) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is [(2R,4R,6S)-5-azido-6-(2,4-dimethylphenyl)sulfanyl-4-fluoro-3-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(2R,4R,6S)-5-azido-6-(2,4-dimethylphenyl)sulfanyl-4-fluoro-3-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 167266539 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [(2R,4R,6S)-5-azido-6-(2,4-dimethylphenyl)sulfanyl-4-fluoro-3-phenylmethoxyoxan-2-yl]methanol |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO)C(OCc3ccccc3)[C@H](F)C2N=[N+]=[N-])c(C)c1 |
| InChI | InChI=1S/C21H24FN3O3S/c1-13-8-9-17(14(2)10-13)29-21-19(24-25-23)18(22)20(16(11-26)28-21)27-12-15-6-4-3-5-7-15/h3-10,16,18-21,26H,11-12H2,1-2H3/t16-,18-,19?,20?,21+/m1/s1 |
| InChIKey | REDUTXCWCVLZEM-LJRUZBCWSA-N |
| XLogP | 4.72 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|