C46H37N5 — CID 167267748
12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-(1,1,3,3-tetramethyl-2H-inden-4-yl)indolo[2,3-a]carbazole (PubChem CID 167267748) has the molecular formula C46H37N5 and a molecular weight of 659.84 g/mol. Its IUPAC name is 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-(1,1,3,3-tetramethyl-2H-inden-4-yl)indolo[2,3-a]carbazole.
| Compound Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-(1,1,3,3-tetramethyl-2H-inden-4-yl)indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167267748 |
| Molecular Formula | C46H37N5 |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-(1,1,3,3-tetramethyl-2H-inden-4-yl)indolo[2,3-a]carbazole |
| SMILES | CC1(C)CC(C)(C)c2c(-n3c4ccccc4c4ccc5c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5c43)cccc21 |
| InChI | InChI=1S/C46H37N5/c1-45(2)28-46(3,4)39-35(45)22-15-25-38(39)50-36-23-13-11-20-31(36)33-26-27-34-32-21-12-14-24-37(32)51(41(34)40(33)50)44-48-42(29-16-7-5-8-17-29)47-43(49-44)30-18-9-6-10-19-30/h5-27H,28H2,1-4H3 |
| InChIKey | GFZAAJBHAFPJNF-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |