C51H47N5 — CID 167268436
5-[4-(3-tert-butylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)indolo[2,3-b]carbazole (PubChem CID 167268436) has the molecular formula C51H47N5 and a molecular weight of 729.97 g/mol. Its IUPAC name is 5-[4-(3-tert-butylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)indolo[2,3-b]carbazole.
| Compound Name | 5-[4-(3-tert-butylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)indolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 167268436 |
| Molecular Formula | C51H47N5 |
| Molecular Weight | 729.97 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | 5-[4-(3-tert-butylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)indolo[2,3-b]carbazole |
| SMILES | CC(C)(C)c1cccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cc5c6ccccc6n(-c6cccc7c6C(C)(C)CCC7(C)C)c5cc43)n2)c1 |
| InChI | InChI=1S/C51H47N5/c1-49(2,3)34-20-15-19-33(29-34)47-52-46(32-17-9-8-10-18-32)53-48(54-47)56-41-25-14-12-22-36(41)38-30-37-35-21-11-13-24-40(35)55(43(37)31-44(38)56)42-26-16-23-39-45(42)51(6,7)28-27-50(39,4)5/h8-26,29-31H,27-28H2,1-7H3 |
| InChIKey | CBIPHVFYCOGGBR-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.97 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |