C48H40FN5 — CID 167268447
5-[4-(3-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)indolo[2,3-b]carbazole (PubChem CID 167268447) has the molecular formula C48H40FN5 and a molecular weight of 705.88 g/mol. Its IUPAC name is 5-[4-(3-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)indolo[2,3-b]carbazole.
| Compound Name | 5-[4-(3-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)indolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 167268447 |
| Molecular Formula | C48H40FN5 |
| Molecular Weight | 705.88 g/mol |
| Exact Mass | 705.33 |
| IUPAC Name | 5-[4-(3-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-7-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)indolo[2,3-b]carbazole |
| SMILES | CC1CC(C)(C)c2cc(-n3c4ccccc4c4cc5c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7cccc(F)c7)n6)c5cc43)ccc2C1(C)C |
| InChI | InChI=1S/C48H40FN5/c1-29-28-47(2,3)39-25-33(22-23-38(39)48(29,4)5)53-40-20-11-9-18-34(40)36-26-37-35-19-10-12-21-41(35)54(43(37)27-42(36)53)46-51-44(30-14-7-6-8-15-30)50-45(52-46)31-16-13-17-32(49)24-31/h6-27,29H,28H2,1-5H3 |
| InChIKey | KHZUCKPVLJKCGF-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.88 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |