C60H49N5 — CID 167269095
7-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole (PubChem CID 167269095) has the molecular formula C60H49N5 and a molecular weight of 840.09 g/mol. Its IUPAC name is 7-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole.
| Compound Name | 7-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 167269095 |
| Molecular Formula | C60H49N5 |
| Molecular Weight | 840.09 g/mol |
| Exact Mass | 839.40 |
| IUPAC Name | 7-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole |
| SMILES | CC1CC(C)(C)c2c(-c3cccc(-n4c5ccccc5c5cc6c7ccccc7n(-c7nc(-c8ccccc8)nc(-c8cccc(-c9ccccc9)c8)n7)c6cc54)c3)cccc2C1(C)C |
| InChI | InChI=1S/C60H49N5/c1-38-37-59(2,3)55-45(29-18-30-50(55)60(38,4)5)42-24-17-26-44(34-42)64-51-31-14-12-27-46(51)48-35-49-47-28-13-15-32-52(47)65(54(49)36-53(48)64)58-62-56(40-21-10-7-11-22-40)61-57(63-58)43-25-16-23-41(33-43)39-19-8-6-9-20-39/h6-36,38H,37H2,1-5H3 |
| InChIKey | BKAJVPCGCUXIGY-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.09 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |