C66H53N5 — CID 167269084
7-[3-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole (PubChem CID 167269084) has the molecular formula C66H53N5 and a molecular weight of 916.19 g/mol. Its IUPAC name is 7-[3-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole.
| Compound Name | 7-[3-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 167269084 |
| Molecular Formula | C66H53N5 |
| Molecular Weight | 916.19 g/mol |
| Exact Mass | 915.43 |
| IUPAC Name | 7-[3-[3-(5,5,6,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)phenyl]phenyl]-5-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-b]carbazole |
| SMILES | CC1CC(C)(C)c2c(-c3cccc(-c4cccc(-n5c6ccccc6c6cc7c8ccccc8n(-c8nc(-c9ccccc9)nc(-c9cccc(-c%10ccccc%10)c9)n8)c7cc65)c4)c3)cccc2C1(C)C |
| InChI | InChI=1S/C66H53N5/c1-42-41-65(2,3)61-51(32-19-33-56(61)66(42,4)5)48-27-16-25-46(36-48)47-26-18-29-50(38-47)70-57-34-14-12-30-52(57)54-39-55-53-31-13-15-35-58(53)71(60(55)40-59(54)70)64-68-62(44-22-10-7-11-23-44)67-63(69-64)49-28-17-24-45(37-49)43-20-8-6-9-21-43/h6-40,42H,41H2,1-5H3 |
| InChIKey | SVANGBFBRADCFB-UHFFFAOYSA-N |
| XLogP | 17.00 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.19 |
| LogP ≤ 5 | 17.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |