About 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine
5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine (PubChem CID 167269509) has the molecular formula C8H8FN3
and a molecular weight of 165.17 g/mol. Its IUPAC name is 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine |
| PubChem CID | 167269509 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine |
| SMILES | CNc1c(F)ncc2[nH]ccc12 |
| InChI | InChI=1S/C8H8FN3/c1-10-7-5-2-3-11-6(5)4-12-8(7)9/h2-4,10-11H,1H3 |
| InChIKey | XEIBRMCWGXGCTE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
The IUPAC name of 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine (CID 167269509) is 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine.
What is the SMILES notation for 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
The canonical SMILES for 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine is CNc1c(F)ncc2[nH]ccc12.
What is the InChIKey of 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
The InChIKey is XEIBRMCWGXGCTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3/c1-10-7-5-2-3-11-6(5)4-12-8(7)9/h2-4,10-11H,1H3.
What are the key properties of 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine has a molecular weight of 165.17 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine is sourced from PubChem (CID 167269509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).