C8H8FN3 — CID 167269509
5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine (PubChem CID 167269509) has the molecular formula C8H8FN3 and a molecular weight of 165.17 g/mol. Its IUPAC name is 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine.
| Compound Name | 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 167269509 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 5-fluoro-N-methyl-1H-pyrrolo[2,3-c]pyridin-4-amine |
| SMILES | CNc1c(F)ncc2[nH]ccc12 |
| InChI | InChI=1S/C8H8FN3/c1-10-7-5-2-3-11-6(5)4-12-8(7)9/h2-4,10-11H,1H3 |
| InChIKey | XEIBRMCWGXGCTE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|