About 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen
4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen (PubChem CID 163390564) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen.
Analyze 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen?
The IUPAC name of 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen (CID 163390564) is 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen.
What is the SMILES notation for 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen?
The canonical SMILES for 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen is Cc1cncc2[nH]ccc12.[H][H].
What is the InChIKey of 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen?
The InChIKey is WGDPJBLGKSMKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.H2/c1-6-4-9-5-8-7(6)2-3-10-8;/h2-5,10H,1H3;1H.
What are the key properties of 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen?
4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen has a molecular weight of 134.18 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-pyrrolo[2,3-c]pyridine;molecular hydrogen is sourced from PubChem (CID 163390564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).