About 4-bromo-1H-indole;ethane;4-methyl-1H-indole
4-bromo-1H-indole;ethane;4-methyl-1H-indole (PubChem CID 162234871) has the molecular formula C25H39BrN2
and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-bromo-1H-indole;ethane;4-methyl-1H-indole.
Molecular Properties
| Compound Name | 4-bromo-1H-indole;ethane;4-methyl-1H-indole |
| PubChem CID | 162234871 |
| Molecular Formula | C25H39BrN2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-bromo-1H-indole;ethane;4-methyl-1H-indole |
| SMILES | Brc1cccc2[nH]ccc12.CC.CC.CC.CC.Cc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C9H9N.C8H6BrN.4C2H6/c1-7-3-2-4-9-8(7)5-6-10-9;9-7-2-1-3-8-6(7)4-5-10-8;4*1-2/h2-6,10H,1H3;1-5,10H;4*1-2H3 |
| InChIKey | ZVXSAAFYWMZUTL-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-bromo-1H-indole;ethane;4-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-indole;ethane;4-methyl-1H-indole?
The IUPAC name of 4-bromo-1H-indole;ethane;4-methyl-1H-indole (CID 162234871) is 4-bromo-1H-indole;ethane;4-methyl-1H-indole.
What is the SMILES notation for 4-bromo-1H-indole;ethane;4-methyl-1H-indole?
The canonical SMILES for 4-bromo-1H-indole;ethane;4-methyl-1H-indole is Brc1cccc2[nH]ccc12.CC.CC.CC.CC.Cc1cccc2[nH]ccc12.
What is the InChIKey of 4-bromo-1H-indole;ethane;4-methyl-1H-indole?
The InChIKey is ZVXSAAFYWMZUTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C8H6BrN.4C2H6/c1-7-3-2-4-9-8(7)5-6-10-9;9-7-2-1-3-8-6(7)4-5-10-8;4*1-2/h2-6,10H,1H3;1-5,10H;4*1-2H3.
What are the key properties of 4-bromo-1H-indole;ethane;4-methyl-1H-indole?
4-bromo-1H-indole;ethane;4-methyl-1H-indole has a molecular weight of 447.51 g/mol, XLogP of 9.51, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-indole;ethane;4-methyl-1H-indole is sourced from PubChem (CID 162234871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).