About ethyl formate;4-methyl-1H-indole
ethyl formate;4-methyl-1H-indole (PubChem CID 159042142) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is ethyl formate;4-methyl-1H-indole.
Molecular Properties
| Compound Name | ethyl formate;4-methyl-1H-indole |
| PubChem CID | 159042142 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethyl formate;4-methyl-1H-indole |
| SMILES | CCOC=O.Cc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C9H9N.C3H6O2/c1-7-3-2-4-9-8(7)5-6-10-9;1-2-5-3-4/h2-6,10H,1H3;3H,2H2,1H3 |
| InChIKey | JWESYINYWLQSEK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;4-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;4-methyl-1H-indole?
The IUPAC name of ethyl formate;4-methyl-1H-indole (CID 159042142) is ethyl formate;4-methyl-1H-indole.
What is the SMILES notation for ethyl formate;4-methyl-1H-indole?
The canonical SMILES for ethyl formate;4-methyl-1H-indole is CCOC=O.Cc1cccc2[nH]ccc12.
What is the InChIKey of ethyl formate;4-methyl-1H-indole?
The InChIKey is JWESYINYWLQSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C3H6O2/c1-7-3-2-4-9-8(7)5-6-10-9;1-2-5-3-4/h2-6,10H,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;4-methyl-1H-indole?
ethyl formate;4-methyl-1H-indole has a molecular weight of 205.26 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;4-methyl-1H-indole is sourced from PubChem (CID 159042142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).