About ethyl formate;4-methoxy-1H-indole
ethyl formate;4-methoxy-1H-indole (PubChem CID 175194292) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl formate;4-methoxy-1H-indole.
Molecular Properties
| Compound Name | ethyl formate;4-methoxy-1H-indole |
| PubChem CID | 175194292 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl formate;4-methoxy-1H-indole |
| SMILES | CCOC=O.COc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C9H9NO.C3H6O2/c1-11-9-4-2-3-8-7(9)5-6-10-8;1-2-5-3-4/h2-6,10H,1H3;3H,2H2,1H3 |
| InChIKey | SURWRFCBZOWAPT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;4-methoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;4-methoxy-1H-indole?
The IUPAC name of ethyl formate;4-methoxy-1H-indole (CID 175194292) is ethyl formate;4-methoxy-1H-indole.
What is the SMILES notation for ethyl formate;4-methoxy-1H-indole?
The canonical SMILES for ethyl formate;4-methoxy-1H-indole is CCOC=O.COc1cccc2[nH]ccc12.
What is the InChIKey of ethyl formate;4-methoxy-1H-indole?
The InChIKey is SURWRFCBZOWAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO.C3H6O2/c1-11-9-4-2-3-8-7(9)5-6-10-8;1-2-5-3-4/h2-6,10H,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;4-methoxy-1H-indole?
ethyl formate;4-methoxy-1H-indole has a molecular weight of 221.26 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;4-methoxy-1H-indole is sourced from PubChem (CID 175194292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).