C26H40N7O6P — CID 167269754
N-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(1-hydroxy-2-methyl-1-pentoxypropan-2-yl)amino]phosphoryl]-2-methoxybenzamide (PubChem CID 167269754) has the molecular formula C26H40N7O6P and a molecular weight of 577.62 g/mol. Its IUPAC name is N-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(1-hydroxy-2-methyl-1-pentoxypropan-2-yl)amino]phosphoryl]-2-methoxybenzamide.
| Compound Name | N-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(1-hydroxy-2-methyl-1-pentoxypropan-2-yl)amino]phosphoryl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 167269754 |
| Molecular Formula | C26H40N7O6P |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | N-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(1-hydroxy-2-methyl-1-pentoxypropan-2-yl)amino]phosphoryl]-2-methoxybenzamide |
| SMILES | CCCCCOC(O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C26H40N7O6P/c1-6-7-10-13-38-25(35)26(3,4)32-40(36,31-24(34)19-11-8-9-12-20(19)37-5)17-39-18(2)14-33-16-30-21-22(27)28-15-29-23(21)33/h8-9,11-12,15-16,18,25,35H,6-7,10,13-14,17H2,1-5H3,(H2,27,28,29)(H2,31,32,34,36)/t18-,25?,40?/m1/s1 |
| InChIKey | JKUMNOXDWMURCH-IJXLAUNBSA-N |
| XLogP | 3.30 |
| TPSA | 175.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|