C29H32F3N5O4 — CID 167270237
2-[4-(4-methoxyphenoxy)phenyl]-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 167270237) has the molecular formula C29H32F3N5O4 and a molecular weight of 571.60 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenoxy)phenyl]-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 2-[4-(4-methoxyphenoxy)phenyl]-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 167270237 |
| Molecular Formula | C29H32F3N5O4 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 2-[4-(4-methoxyphenoxy)phenyl]-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | COc1ccc(Oc2ccc(-c3nc4n(c3C(N)=O)NCCC4C3CCN(C(O)/C=C/C(F)(F)F)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H32F3N5O4/c1-40-20-6-8-22(9-7-20)41-21-4-2-19(3-5-21)25-26(27(33)39)37-28(35-25)23(11-15-34-37)18-12-16-36(17-13-18)24(38)10-14-29(30,31)32/h2-10,14,18,23-24,34,38H,11-13,15-17H2,1H3,(H2,33,39)/b14-10+ |
| InChIKey | OTJCRMFJUKCDMY-GXDHUFHOSA-N |
| XLogP | 4.63 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|