C28H30N4O3 — CID 167579451
2-(4-phenoxyphenyl)-8-(1-prop-2-enoylpiperidin-4-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 167579451) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-(4-phenoxyphenyl)-8-(1-prop-2-enoylpiperidin-4-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-(4-phenoxyphenyl)-8-(1-prop-2-enoylpiperidin-4-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167579451 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-(4-phenoxyphenyl)-8-(1-prop-2-enoylpiperidin-4-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(C2CCCn3c2nc(-c2ccc(Oc4ccccc4)cc2)c3C(N)=O)CC1 |
| InChI | InChI=1S/C28H30N4O3/c1-2-24(33)31-17-14-19(15-18-31)23-9-6-16-32-26(27(29)34)25(30-28(23)32)20-10-12-22(13-11-20)35-21-7-4-3-5-8-21/h2-5,7-8,10-13,19,23H,1,6,9,14-18H2,(H2,29,34) |
| InChIKey | GZDXHKZAEMNEEX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|