C28H30F3N5O3 — CID 167270276
2-(4-phenoxyphenyl)-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 167270276) has the molecular formula C28H30F3N5O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is 2-(4-phenoxyphenyl)-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 2-(4-phenoxyphenyl)-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 167270276 |
| Molecular Formula | C28H30F3N5O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-(4-phenoxyphenyl)-8-[1-[(E)-4,4,4-trifluoro-1-hydroxybut-2-enyl]piperidin-4-yl]-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)nc2n1NCCC2C1CCN(C(O)/C=C/C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H30F3N5O3/c29-28(30,31)14-10-23(37)35-16-12-18(13-17-35)22-11-15-33-36-25(26(32)38)24(34-27(22)36)19-6-8-21(9-7-19)39-20-4-2-1-3-5-20/h1-10,14,18,22-23,33,37H,11-13,15-17H2,(H2,32,38)/b14-10+ |
| InChIKey | MUKJVXZDNZVUOZ-GXDHUFHOSA-N |
| XLogP | 4.62 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|