C26H27N5O2 — CID 175551169
8-(1-but-2-ynylazetidin-3-yl)-2-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 175551169) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 8-(1-but-2-ynylazetidin-3-yl)-2-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 8-(1-but-2-ynylazetidin-3-yl)-2-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175551169 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 8-(1-but-2-ynylazetidin-3-yl)-2-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CC#CCN1CC(C2CCNn3c2nc(-c2ccc(Oc4ccccc4)cc2)c3C(N)=O)C1 |
| InChI | InChI=1S/C26H27N5O2/c1-2-3-15-30-16-19(17-30)22-13-14-28-31-24(25(27)32)23(29-26(22)31)18-9-11-21(12-10-18)33-20-7-5-4-6-8-20/h4-12,19,22,28H,13-17H2,1H3,(H2,27,32) |
| InChIKey | BSBOUMCYBVJZRU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|