C14H29N5O — CID 167270444
N-[2-(2-aminohex-1-en-3-ylamino)-1-(methylamino)prop-2-enyl]-2-(methylamino)propanamide (PubChem CID 167270444) has the molecular formula C14H29N5O and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[2-(2-aminohex-1-en-3-ylamino)-1-(methylamino)prop-2-enyl]-2-(methylamino)propanamide.
| Compound Name | N-[2-(2-aminohex-1-en-3-ylamino)-1-(methylamino)prop-2-enyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 167270444 |
| Molecular Formula | C14H29N5O |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | N-[2-(2-aminohex-1-en-3-ylamino)-1-(methylamino)prop-2-enyl]-2-(methylamino)propanamide |
| SMILES | C=C(N)C(CCC)NC(=C)C(NC)NC(=O)C(C)NC |
| InChI | InChI=1S/C14H29N5O/c1-7-8-12(9(2)15)18-10(3)13(17-6)19-14(20)11(4)16-5/h11-13,16-18H,2-3,7-8,15H2,1,4-6H3,(H,19,20) |
| InChIKey | FYPPEZBWLUHOGJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|