C29H39N3O6S2 — CID 167272308
N-[3-(tert-butylsulfamoyl)phenyl]-4-(3-methyloxetan-3-yl)sulfonyl-2-(4-propan-2-ylidenepiperidin-1-yl)benzamide (PubChem CID 167272308) has the molecular formula C29H39N3O6S2 and a molecular weight of 589.78 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)phenyl]-4-(3-methyloxetan-3-yl)sulfonyl-2-(4-propan-2-ylidenepiperidin-1-yl)benzamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)phenyl]-4-(3-methyloxetan-3-yl)sulfonyl-2-(4-propan-2-ylidenepiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 167272308 |
| Molecular Formula | C29H39N3O6S2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)phenyl]-4-(3-methyloxetan-3-yl)sulfonyl-2-(4-propan-2-ylidenepiperidin-1-yl)benzamide |
| SMILES | CC(C)=C1CCN(c2cc(S(=O)(=O)C3(C)COC3)ccc2C(=O)Nc2cccc(S(=O)(=O)NC(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C29H39N3O6S2/c1-20(2)21-12-14-32(15-13-21)26-17-23(39(34,35)29(6)18-38-19-29)10-11-25(26)27(33)30-22-8-7-9-24(16-22)40(36,37)31-28(3,4)5/h7-11,16-17,31H,12-15,18-19H2,1-6H3,(H,30,33) |
| InChIKey | MINXCTUKDMAKDZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|