C18H20N4O5S — CID 167273669
5-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-6-yl]pent-4-ynyl methanesulfonate (PubChem CID 167273669) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 5-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-6-yl]pent-4-ynyl methanesulfonate.
| Compound Name | 5-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-6-yl]pent-4-ynyl methanesulfonate |
|---|---|
| PubChem CID | 167273669 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 5-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-6-yl]pent-4-ynyl methanesulfonate |
| SMILES | Cn1nc(N2CCC(=O)NC2=O)c2ccc(C#CCCCOS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C18H20N4O5S/c1-21-15-12-13(6-4-3-5-11-27-28(2,25)26)7-8-14(15)17(20-21)22-10-9-16(23)19-18(22)24/h7-8,12H,3,5,9-11H2,1-2H3,(H,19,23,24) |
| InChIKey | ZYWCOKGUZMWKTF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|