C17H18N4O5S — CID 172541180
4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-5-yl]but-3-ynyl methanesulfonate (PubChem CID 172541180) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-5-yl]but-3-ynyl methanesulfonate.
| Compound Name | 4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-5-yl]but-3-ynyl methanesulfonate |
|---|---|
| PubChem CID | 172541180 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazol-5-yl]but-3-ynyl methanesulfonate |
| SMILES | Cn1nc(N2CCC(=O)NC2=O)c2cc(C#CCCOS(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H18N4O5S/c1-20-14-7-6-12(5-3-4-10-26-27(2,24)25)11-13(14)16(19-20)21-9-8-15(22)18-17(21)23/h6-7,11H,4,8-10H2,1-2H3,(H,18,22,23) |
| InChIKey | UVDVJFBKEVRDMU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|