C24H25ClN3O2S+ — CID 16727666
3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-[(4-nitrophenyl)methyl]azanium (PubChem CID 16727666) has the molecular formula C24H25ClN3O2S+ and a molecular weight of 455.00 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-[(4-nitrophenyl)methyl]azanium.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-[(4-nitrophenyl)methyl]azanium |
|---|---|
| PubChem CID | 16727666 |
| Molecular Formula | C24H25ClN3O2S+ |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)propyl-dimethyl-[(4-nitrophenyl)methyl]azanium |
| SMILES | C[N+](C)(CCCN1c2ccccc2Sc2ccc(Cl)cc21)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25ClN3O2S/c1-28(2,17-18-8-11-20(12-9-18)27(29)30)15-5-14-26-21-6-3-4-7-23(21)31-24-13-10-19(25)16-22(24)26/h3-4,6-13,16H,5,14-15,17H2,1-2H3/q+1 |
| InChIKey | OQFIYDJFNCLREY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|