C6H10O3 — CID 16727774
[(6R)-6-methyl-3,6-dihydro-1,2-dioxin-3-yl]methanol (PubChem CID 16727774) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is [(6R)-6-methyl-3,6-dihydro-1,2-dioxin-3-yl]methanol.
| Compound Name | [(6R)-6-methyl-3,6-dihydro-1,2-dioxin-3-yl]methanol |
|---|---|
| PubChem CID | 16727774 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [(6R)-6-methyl-3,6-dihydro-1,2-dioxin-3-yl]methanol |
| SMILES | C[C@@H]1C=CC(CO)OO1 |
| InChI | InChI=1S/C6H10O3/c1-5-2-3-6(4-7)9-8-5/h2-3,5-7H,4H2,1H3/t5-,6?/m1/s1 |
| InChIKey | AWSOGDJVCAULKU-LWOQYNTDSA-N |
| XLogP | 0.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|