C25H51N5O5 — CID 167279470
N-[(3-aminocyclononyl)methyl]-3-[2-[2-[2-[2-(4-aminopiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 167279470) has the molecular formula C25H51N5O5 and a molecular weight of 501.71 g/mol. Its IUPAC name is N-[(3-aminocyclononyl)methyl]-3-[2-[2-[2-[2-(4-aminopiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-[(3-aminocyclononyl)methyl]-3-[2-[2-[2-[2-(4-aminopiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 167279470 |
| Molecular Formula | C25H51N5O5 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.39 |
| IUPAC Name | N-[(3-aminocyclononyl)methyl]-3-[2-[2-[2-[2-(4-aminopiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | NC1CCCCCCC(CNC(=O)CCOCCOCCOCCOCCN2CCN(N)CC2)C1 |
| InChI | InChI=1S/C25H51N5O5/c26-24-6-4-2-1-3-5-23(21-24)22-28-25(31)7-13-32-15-17-34-19-20-35-18-16-33-14-12-29-8-10-30(27)11-9-29/h23-24H,1-22,26-27H2,(H,28,31) |
| InChIKey | WIVFPIOOHKNZCT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|