C25H29N3O — CID 167279632
N-[(1S,5S)-5-(benzylamino)-1-bicyclo[3.1.0]hexanyl]-N-ethyl-3-methyl-1H-indole-2-carboxamide (PubChem CID 167279632) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-[(1S,5S)-5-(benzylamino)-1-bicyclo[3.1.0]hexanyl]-N-ethyl-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1S,5S)-5-(benzylamino)-1-bicyclo[3.1.0]hexanyl]-N-ethyl-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167279632 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-[(1S,5S)-5-(benzylamino)-1-bicyclo[3.1.0]hexanyl]-N-ethyl-3-methyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1[nH]c2ccccc2c1C)[C@]12CCC[C@]1(NCc1ccccc1)C2 |
| InChI | InChI=1S/C25H29N3O/c1-3-28(23(29)22-18(2)20-12-7-8-13-21(20)27-22)25-15-9-14-24(25,17-25)26-16-19-10-5-4-6-11-19/h4-8,10-13,26-27H,3,9,14-17H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | WQVLRBXSXYWIEC-DQEYMECFSA-N |
| XLogP | 4.79 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|