C46H31N5 — CID 167280732
2-carbazol-9-yl-3-[6-[2-cyano-5-[2-[(1Z)-3-cyanobuta-1,3-dienyl]-3-methylindol-1-yl]phenyl]cyclohexa-1,5-dien-1-yl]benzonitrile (PubChem CID 167280732) has the molecular formula C46H31N5 and a molecular weight of 653.79 g/mol. Its IUPAC name is 2-carbazol-9-yl-3-[6-[2-cyano-5-[2-[(1Z)-3-cyanobuta-1,3-dienyl]-3-methylindol-1-yl]phenyl]cyclohexa-1,5-dien-1-yl]benzonitrile.
| Compound Name | 2-carbazol-9-yl-3-[6-[2-cyano-5-[2-[(1Z)-3-cyanobuta-1,3-dienyl]-3-methylindol-1-yl]phenyl]cyclohexa-1,5-dien-1-yl]benzonitrile |
|---|---|
| PubChem CID | 167280732 |
| Molecular Formula | C46H31N5 |
| Molecular Weight | 653.79 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | 2-carbazol-9-yl-3-[6-[2-cyano-5-[2-[(1Z)-3-cyanobuta-1,3-dienyl]-3-methylindol-1-yl]phenyl]cyclohexa-1,5-dien-1-yl]benzonitrile |
| SMILES | C=C(C#N)/C=C\c1c(C)c2ccccc2n1-c1ccc(C#N)c(C2=CCCC=C2c2cccc(C#N)c2-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C46H31N5/c1-30(27-47)22-25-42-31(2)35-13-5-8-19-43(35)50(42)34-24-23-32(28-48)41(26-34)37-15-4-3-14-36(37)40-18-11-12-33(29-49)46(40)51-44-20-9-6-16-38(44)39-17-7-10-21-45(39)51/h5-26H,1,3-4H2,2H3/b25-22- |
| InChIKey | HDFNIYGFLLKTND-LVWGJNHUSA-N |
| XLogP | 11.13 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.79 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|