C13H11N3O2 — CID 167286870
(6-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methanediol (PubChem CID 167286870) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is (6-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methanediol.
| Compound Name | (6-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methanediol |
|---|---|
| PubChem CID | 167286870 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (6-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methanediol |
| SMILES | OC(O)c1cc2ccc(-c3cccnc3)nc2[nH]1 |
| InChI | InChI=1S/C13H11N3O2/c17-13(18)11-6-8-3-4-10(15-12(8)16-11)9-2-1-5-14-7-9/h1-7,13,17-18H,(H,15,16) |
| InChIKey | QSWNMOWWKJYCBU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|