C22H16Cl2N4O4 — CID 167288657
3-(4,6-dichloro-3-pyridinyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]prop-2-ynamide (PubChem CID 167288657) has the molecular formula C22H16Cl2N4O4 and a molecular weight of 471.30 g/mol. Its IUPAC name is 3-(4,6-dichloro-3-pyridinyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]prop-2-ynamide.
| Compound Name | 3-(4,6-dichloro-3-pyridinyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 167288657 |
| Molecular Formula | C22H16Cl2N4O4 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 3-(4,6-dichloro-3-pyridinyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1cnc(Cl)cc1Cl)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H16Cl2N4O4/c23-16-8-18(24)25-10-13(16)2-5-19(29)26-9-12-1-3-15-14(7-12)11-28(22(15)32)17-4-6-20(30)27-21(17)31/h1,3,7-8,10,17H,4,6,9,11H2,(H,26,29)(H,27,30,31) |
| InChIKey | LBSYZYYSOZIGIU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|