C30H29N3O8 — CID 167288630
2,2-dimethylpropanoyloxymethyl 2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]benzoate (PubChem CID 167288630) has the molecular formula C30H29N3O8 and a molecular weight of 559.58 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]benzoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 167288630 |
| Molecular Formula | C30H29N3O8 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]benzoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)c1ccccc1C#CC(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H29N3O8/c1-30(2,3)29(39)41-17-40-28(38)22-7-5-4-6-19(22)9-12-24(34)31-15-18-8-10-21-20(14-18)16-33(27(21)37)23-11-13-25(35)32-26(23)36/h4-8,10,14,23H,11,13,15-17H2,1-3H3,(H,31,34)(H,32,35,36) |
| InChIKey | OTPDYVSRJDGXAT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|