C27H25N3O6 — CID 167288645
[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]phenyl] 2-methylpropanoate (PubChem CID 167288645) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is [2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]phenyl] 2-methylpropanoate.
| Compound Name | [2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 167288645 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylamino]-3-oxoprop-1-ynyl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccccc1C#CC(=O)NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H25N3O6/c1-16(2)27(35)36-22-6-4-3-5-18(22)8-11-23(31)28-14-17-7-9-20-19(13-17)15-30(26(20)34)21-10-12-24(32)29-25(21)33/h3-7,9,13,16,21H,10,12,14-15H2,1-2H3,(H,28,31)(H,29,32,33) |
| InChIKey | WJMMHYINACTSQM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|