C42H81N7O9 — CID 167290398
2,2-bis[3-[3-(4-methylpiperazin-1-yl)propylamino]propanoyloxymethyl]butyl 4-[4-hydroxybutyl-(3-methoxy-3-oxopropyl)amino]-4-methylpentanoate (PubChem CID 167290398) has the molecular formula C42H81N7O9 and a molecular weight of 828.15 g/mol. Its IUPAC name is 2,2-bis[3-[3-(4-methylpiperazin-1-yl)propylamino]propanoyloxymethyl]butyl 4-[4-hydroxybutyl-(3-methoxy-3-oxopropyl)amino]-4-methylpentanoate.
| Compound Name | 2,2-bis[3-[3-(4-methylpiperazin-1-yl)propylamino]propanoyloxymethyl]butyl 4-[4-hydroxybutyl-(3-methoxy-3-oxopropyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 167290398 |
| Molecular Formula | C42H81N7O9 |
| Molecular Weight | 828.15 g/mol |
| Exact Mass | 827.61 |
| IUPAC Name | 2,2-bis[3-[3-(4-methylpiperazin-1-yl)propylamino]propanoyloxymethyl]butyl 4-[4-hydroxybutyl-(3-methoxy-3-oxopropyl)amino]-4-methylpentanoate |
| SMILES | CCC(COC(=O)CCNCCCN1CCN(C)CC1)(COC(=O)CCNCCCN1CCN(C)CC1)COC(=O)CCC(C)(C)N(CCCCO)CCC(=O)OC |
| InChI | InChI=1S/C42H81N7O9/c1-7-42(35-57-39(53)13-19-43-17-10-21-47-29-25-45(4)26-30-47,36-58-40(54)14-20-44-18-11-22-48-31-27-46(5)28-32-48)34-56-38(52)12-16-41(2,3)49(23-8-9-33-50)24-15-37(51)55-6/h43-44,50H,7-36H2,1-6H3 |
| InChIKey | JQRVMZXFRVXYKD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|