C14H22N2 — CID 167290552
(3Z)-1-tert-butyl-N-ethenyl-3-prop-2-enylidenepiperidin-4-imine (PubChem CID 167290552) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (3Z)-1-tert-butyl-N-ethenyl-3-prop-2-enylidenepiperidin-4-imine.
| Compound Name | (3Z)-1-tert-butyl-N-ethenyl-3-prop-2-enylidenepiperidin-4-imine |
|---|---|
| PubChem CID | 167290552 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3Z)-1-tert-butyl-N-ethenyl-3-prop-2-enylidenepiperidin-4-imine |
| SMILES | C=C/C=C1/CN(C(C)(C)C)CC/C1=N\C=C |
| InChI | InChI=1S/C14H22N2/c1-6-8-12-11-16(14(3,4)5)10-9-13(12)15-7-2/h6-8H,1-2,9-11H2,3-5H3/b12-8-,15-13+ |
| InChIKey | DBRNFVCVCFPBIB-KAIXQLJBSA-N |
| XLogP | 3.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|