C26H23Cl2N5O3 — CID 167291047
6-[5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-1H-indazol-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 167291047) has the molecular formula C26H23Cl2N5O3 and a molecular weight of 524.41 g/mol. Its IUPAC name is 6-[5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-1H-indazol-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-[5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-1H-indazol-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 167291047 |
| Molecular Formula | C26H23Cl2N5O3 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 6-[5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-1H-indazol-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | N[C@@H](Oc1ccc2[nH]nc(-c3ccc4c(c3)C(=O)CC3(CCNCC3)O4)c2c1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C26H23Cl2N5O3/c27-18-12-31-13-19(28)23(18)25(29)35-15-2-3-20-16(10-15)24(33-32-20)14-1-4-22-17(9-14)21(34)11-26(36-22)5-7-30-8-6-26/h1-4,9-10,12-13,25,30H,5-8,11,29H2,(H,32,33)/t25-/m0/s1 |
| InChIKey | NQTMTYCCZVCFDI-VWLOTQADSA-N |
| XLogP | 5.06 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|