C22H23Cl2N7O — CID 174339032
(S)-(3,5-dichloro-4-pyridinyl)-[[3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-1H-indazol-5-yl]oxy]methanamine (PubChem CID 174339032) has the molecular formula C22H23Cl2N7O and a molecular weight of 472.38 g/mol. Its IUPAC name is (S)-(3,5-dichloro-4-pyridinyl)-[[3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-1H-indazol-5-yl]oxy]methanamine.
| Compound Name | (S)-(3,5-dichloro-4-pyridinyl)-[[3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-1H-indazol-5-yl]oxy]methanamine |
|---|---|
| PubChem CID | 174339032 |
| Molecular Formula | C22H23Cl2N7O |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (S)-(3,5-dichloro-4-pyridinyl)-[[3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-1H-indazol-5-yl]oxy]methanamine |
| SMILES | CN1CCC(n2cc(-c3n[nH]c4ccc(O[C@H](N)c5c(Cl)cncc5Cl)cc34)cn2)CC1 |
| InChI | InChI=1S/C22H23Cl2N7O/c1-30-6-4-14(5-7-30)31-12-13(9-27-31)21-16-8-15(2-3-19(16)28-29-21)32-22(25)20-17(23)10-26-11-18(20)24/h2-3,8-12,14,22H,4-7,25H2,1H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | KYHTVFVWBFCCSS-QFIPXVFZSA-N |
| XLogP | 4.43 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|