C21H20Cl2N8O — CID 167156024
(S)-(3,5-dichloro-4-pyridinyl)-[[3-(2-piperazin-1-ylpyrimidin-5-yl)-1H-indazol-5-yl]oxy]methanamine (PubChem CID 167156024) has the molecular formula C21H20Cl2N8O and a molecular weight of 471.35 g/mol. Its IUPAC name is (S)-(3,5-dichloro-4-pyridinyl)-[[3-(2-piperazin-1-ylpyrimidin-5-yl)-1H-indazol-5-yl]oxy]methanamine.
| Compound Name | (S)-(3,5-dichloro-4-pyridinyl)-[[3-(2-piperazin-1-ylpyrimidin-5-yl)-1H-indazol-5-yl]oxy]methanamine |
|---|---|
| PubChem CID | 167156024 |
| Molecular Formula | C21H20Cl2N8O |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (S)-(3,5-dichloro-4-pyridinyl)-[[3-(2-piperazin-1-ylpyrimidin-5-yl)-1H-indazol-5-yl]oxy]methanamine |
| SMILES | N[C@@H](Oc1ccc2[nH]nc(-c3cnc(N4CCNCC4)nc3)c2c1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C21H20Cl2N8O/c22-15-10-26-11-16(23)18(15)20(24)32-13-1-2-17-14(7-13)19(30-29-17)12-8-27-21(28-9-12)31-5-3-25-4-6-31/h1-2,7-11,20,25H,3-6,24H2,(H,29,30)/t20-/m0/s1 |
| InChIKey | MFADJCVDJUNGCE-FQEVSTJZSA-N |
| XLogP | 3.17 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|