C9H16N2 — CID 167293761
6-methyl-2,8-diazaspiro[3.6]dec-5-ene (PubChem CID 167293761) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 6-methyl-2,8-diazaspiro[3.6]dec-5-ene.
| Compound Name | 6-methyl-2,8-diazaspiro[3.6]dec-5-ene |
|---|---|
| PubChem CID | 167293761 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 6-methyl-2,8-diazaspiro[3.6]dec-5-ene |
| SMILES | CC1=CC2(CCNC1)CNC2 |
| InChI | InChI=1S/C9H16N2/c1-8-4-9(6-11-7-9)2-3-10-5-8/h4,10-11H,2-3,5-7H2,1H3 |
| InChIKey | RDQRQTZUNKXNFA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|