C9H19FN2 — CID 167295224
(3R,4S)-4-fluoro-N,1,4-trimethylazepan-3-amine (PubChem CID 167295224) has the molecular formula C9H19FN2 and a molecular weight of 174.26 g/mol. Its IUPAC name is (3R,4S)-4-fluoro-N,1,4-trimethylazepan-3-amine.
| Compound Name | (3R,4S)-4-fluoro-N,1,4-trimethylazepan-3-amine |
|---|---|
| PubChem CID | 167295224 |
| Molecular Formula | C9H19FN2 |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | (3R,4S)-4-fluoro-N,1,4-trimethylazepan-3-amine |
| SMILES | CN[C@@H]1CN(C)CCC[C@]1(C)F |
| InChI | InChI=1S/C9H19FN2/c1-9(10)5-4-6-12(3)7-8(9)11-2/h8,11H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | YOZUUBAZJUCGQQ-BDAKNGLRSA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |