C15H32N2 — CID 167295356
N'-(5,5-dimethylhex-1-en-2-yl)-N-(2,2-dimethylpropyl)-N'-methylmethanediamine (PubChem CID 167295356) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is N'-(5,5-dimethylhex-1-en-2-yl)-N-(2,2-dimethylpropyl)-N'-methylmethanediamine.
| Compound Name | N'-(5,5-dimethylhex-1-en-2-yl)-N-(2,2-dimethylpropyl)-N'-methylmethanediamine |
|---|---|
| PubChem CID | 167295356 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N'-(5,5-dimethylhex-1-en-2-yl)-N-(2,2-dimethylpropyl)-N'-methylmethanediamine |
| SMILES | C=C(CCC(C)(C)C)N(C)CNCC(C)(C)C |
| InChI | InChI=1S/C15H32N2/c1-13(9-10-14(2,3)4)17(8)12-16-11-15(5,6)7/h16H,1,9-12H2,2-8H3 |
| InChIKey | XRAMHUJSOJXWNP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|