C8H17NO2S — CID 167295550
2-[(6S)-4-sulfanyl-1,4-oxazepan-6-yl]propan-2-ol (PubChem CID 167295550) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-[(6S)-4-sulfanyl-1,4-oxazepan-6-yl]propan-2-ol.
| Compound Name | 2-[(6S)-4-sulfanyl-1,4-oxazepan-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 167295550 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 2-[(6S)-4-sulfanyl-1,4-oxazepan-6-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1COCCN(S)C1 |
| InChI | InChI=1S/C8H17NO2S/c1-8(2,10)7-5-9(12)3-4-11-6-7/h7,10,12H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | SULFSEDYLAISEI-ZETCQYMHSA-N |
| XLogP | 0.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|