C23H28FNO — CID 167299178
(2R)-2-(3-fluoro-4-phenylphenyl)-6-piperidin-1-ylhexan-3-one (PubChem CID 167299178) has the molecular formula C23H28FNO and a molecular weight of 353.48 g/mol. Its IUPAC name is (2R)-2-(3-fluoro-4-phenylphenyl)-6-piperidin-1-ylhexan-3-one.
| Compound Name | (2R)-2-(3-fluoro-4-phenylphenyl)-6-piperidin-1-ylhexan-3-one |
|---|---|
| PubChem CID | 167299178 |
| Molecular Formula | C23H28FNO |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2R)-2-(3-fluoro-4-phenylphenyl)-6-piperidin-1-ylhexan-3-one |
| SMILES | C[C@@H](C(=O)CCCN1CCCCC1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C23H28FNO/c1-18(23(26)11-8-16-25-14-6-3-7-15-25)20-12-13-21(22(24)17-20)19-9-4-2-5-10-19/h2,4-5,9-10,12-13,17-18H,3,6-8,11,14-16H2,1H3/t18-/m1/s1 |
| InChIKey | BGPOGANZDXOTFF-GOSISDBHSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |