C20H12ClF4N5O — CID 167302711
[[5-chloro-6-(triazol-2-yl)-3-pyridinyl]amino]-[4-(2,4-difluorophenyl)-2,5-difluorophenyl]methanol (PubChem CID 167302711) has the molecular formula C20H12ClF4N5O and a molecular weight of 449.80 g/mol. Its IUPAC name is [[5-chloro-6-(triazol-2-yl)-3-pyridinyl]amino]-[4-(2,4-difluorophenyl)-2,5-difluorophenyl]methanol.
| Compound Name | [[5-chloro-6-(triazol-2-yl)-3-pyridinyl]amino]-[4-(2,4-difluorophenyl)-2,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 167302711 |
| Molecular Formula | C20H12ClF4N5O |
| Molecular Weight | 449.80 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | [[5-chloro-6-(triazol-2-yl)-3-pyridinyl]amino]-[4-(2,4-difluorophenyl)-2,5-difluorophenyl]methanol |
| SMILES | OC(Nc1cnc(-n2nccn2)c(Cl)c1)c1cc(F)c(-c2ccc(F)cc2F)cc1F |
| InChI | InChI=1S/C20H12ClF4N5O/c21-15-6-11(9-26-19(15)30-27-3-4-28-30)29-20(31)14-8-17(24)13(7-18(14)25)12-2-1-10(22)5-16(12)23/h1-9,20,29,31H |
| InChIKey | MCWNKQCDRXNHQA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|