C19H18N4O2 — CID 16730500
5-nitro-3-[(E)-2-phenylethenyl]-6-pyrrolidin-1-yl-1H-indazole (PubChem CID 16730500) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-nitro-3-[(E)-2-phenylethenyl]-6-pyrrolidin-1-yl-1H-indazole.
| Compound Name | 5-nitro-3-[(E)-2-phenylethenyl]-6-pyrrolidin-1-yl-1H-indazole |
|---|---|
| PubChem CID | 16730500 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-nitro-3-[(E)-2-phenylethenyl]-6-pyrrolidin-1-yl-1H-indazole |
| SMILES | O=[N+]([O-])c1cc2c(/C=C/c3ccccc3)n[nH]c2cc1N1CCCC1 |
| InChI | InChI=1S/C19H18N4O2/c24-23(25)19-12-15-16(9-8-14-6-2-1-3-7-14)20-21-17(15)13-18(19)22-10-4-5-11-22/h1-3,6-9,12-13H,4-5,10-11H2,(H,20,21)/b9-8+ |
| InChIKey | HBGNZQRVHBIHPS-CMDGGOBGSA-N |
| XLogP | 4.24 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|