C20H31N3O2 — CID 167312043
benzyl N-[2-(4-piperidin-4-ylpiperidin-1-yl)ethyl]carbamate (PubChem CID 167312043) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is benzyl N-[2-(4-piperidin-4-ylpiperidin-1-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-(4-piperidin-4-ylpiperidin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 167312043 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | benzyl N-[2-(4-piperidin-4-ylpiperidin-1-yl)ethyl]carbamate |
| SMILES | O=C(NCCN1CCC(C2CCNCC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C20H31N3O2/c24-20(25-16-17-4-2-1-3-5-17)22-12-15-23-13-8-19(9-14-23)18-6-10-21-11-7-18/h1-5,18-19,21H,6-16H2,(H,22,24) |
| InChIKey | IFNOBUASLAJWJU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |